C20H26ClF3N6O4S — CID 164757962
tert-butyl N-[[2-(7-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)-2-azaspiro[3.3]heptan-6-yl]-(2,2,2-trifluoroethyl)sulfamoyl]carbamate (PubChem CID 164757962) has the molecular formula C20H26ClF3N6O4S and a molecular weight of 538.98 g/mol. Its IUPAC name is tert-butyl N-[[2-(7-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)-2-azaspiro[3.3]heptan-6-yl]-(2,2,2-trifluoroethyl)sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[[2-(7-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)-2-azaspiro[3.3]heptan-6-yl]-(2,2,2-trifluoroethyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 164757962 |
| Molecular Formula | C20H26ClF3N6O4S |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | tert-butyl N-[[2-(7-chloro-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-yl)-2-azaspiro[3.3]heptan-6-yl]-(2,2,2-trifluoroethyl)sulfamoyl]carbamate |
| SMILES | Cc1cc(Cl)n2ncnc(N3CC4(CC(N(CC(F)(F)F)S(=O)(=O)NC(=O)OC(C)(C)C)C4)C3)c12 |
| InChI | InChI=1S/C20H26ClF3N6O4S/c1-12-5-14(21)30-15(12)16(25-11-26-30)28-8-19(9-28)6-13(7-19)29(10-20(22,23)24)35(32,33)27-17(31)34-18(2,3)4/h5,11,13H,6-10H2,1-4H3,(H,27,31) |
| InChIKey | VBDVYWPUUKGJNX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |