C44H40N4O2S4 — CID 164759381
CID 164759381 (PubChem CID 164759381) has the molecular formula C44H40N4O2S4 and a molecular weight of 785.10 g/mol.
| Compound Name | CID 164759381 |
|---|---|
| PubChem CID | 164759381 |
| Molecular Formula | C44H40N4O2S4 |
| Molecular Weight | 785.10 g/mol |
| Exact Mass | 784.20 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C\c1cc(OCCC)c(C2=Cc3sc4c(c3C23CCCCC3)C2(CCCCC2)c2cc(-c3sc(/C=C(\C#N)[N+]#[C-])cc3OCCC)sc2-4)s1 |
| InChI | InChI=1S/C44H40N4O2S4/c1-5-17-49-33-21-29(19-27(25-45)47-3)51-39(33)31-23-35-37(43(31)13-9-7-10-14-43)38-42(53-35)40-32(44(38)15-11-8-12-16-44)24-36(54-40)41-34(50-18-6-2)22-30(52-41)20-28(26-46)48-4/h19-24H,5-18H2,1-2H3/b27-19-,28-20+ |
| InChIKey | BQQQOQQSYMJSRE-RIRMOVKSSA-N |
| XLogP | 13.73 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.10 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|