C38H28N4S4 — CID 164765086
CID 164765086 (PubChem CID 164765086) has the molecular formula C38H28N4S4 and a molecular weight of 668.94 g/mol.
| Compound Name | CID 164765086 |
|---|---|
| PubChem CID | 164765086 |
| Molecular Formula | C38H28N4S4 |
| Molecular Weight | 668.94 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(-c2cc3sc4c(c3s2)C2(CCCCC2)C2=C4C3(CCCCC3)C(c3ccc(/C=C(\C#N)[N+]#[C-])s3)=C2)s1 |
| InChI | InChI=1S/C38H28N4S4/c1-41-23(21-39)17-25-9-11-29(43-25)27-19-28-33(37(27)13-5-3-6-14-37)36-34(38(28)15-7-4-8-16-38)35-32(46-36)20-31(45-35)30-12-10-26(44-30)18-24(22-40)42-2/h9-12,17-20H,3-8,13-16H2/b23-17+,24-18- |
| InChIKey | ZFTMKYRDVFKXMZ-QEYUTVSCSA-N |
| XLogP | 12.34 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.94 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|