C24H16N4S3 — CID 153318029
(Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]-3,4-diethylthiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 153318029) has the molecular formula C24H16N4S3 and a molecular weight of 456.62 g/mol. Its IUPAC name is (Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]-3,4-diethylthiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]-3,4-diethylthiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 153318029 |
| Molecular Formula | C24H16N4S3 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | (Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]thiophen-2-yl]-3,4-diethylthiophen-2-yl]thiophen-2-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(-c2sc(-c3ccc(/C=C(\C#N)[N+]#[C-])s3)c(CC)c2CC)s1 |
| InChI | InChI=1S/C24H16N4S3/c1-5-19-20(6-2)24(22-10-8-18(30-22)12-16(14-26)28-4)31-23(19)21-9-7-17(29-21)11-15(13-25)27-3/h7-12H,5-6H2,1-2H3/b15-11-,16-12+ |
| InChIKey | YKTKOWGBQFTOGD-UKVBVZPVSA-N |
| XLogP | 7.90 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|