C23H11N5S2 — CID 140913430
(Z)-3-[7-benzyl-10-[(E)-2-cyano-2-isocyanoethenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 140913430) has the molecular formula C23H11N5S2 and a molecular weight of 421.51 g/mol. Its IUPAC name is (Z)-3-[7-benzyl-10-[(E)-2-cyano-2-isocyanoethenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (Z)-3-[7-benzyl-10-[(E)-2-cyano-2-isocyanoethenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 140913430 |
| Molecular Formula | C23H11N5S2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | (Z)-3-[7-benzyl-10-[(E)-2-cyano-2-isocyanoethenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1cc2c(s1)c1sc(/C=C(\C#N)[N+]#[C-])cc1n2Cc1ccccc1 |
| InChI | InChI=1S/C23H11N5S2/c1-26-16(12-24)8-18-10-20-22(29-18)23-21(11-19(30-23)9-17(13-25)27-2)28(20)14-15-6-4-3-5-7-15/h3-11H,14H2/b16-8-,17-9+ |
| InChIKey | CTTHXPOVCSPKCS-VAQFQWRASA-N |
| XLogP | 6.53 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|