About CID 164759097
CID 164759097 (PubChem CID 164759097) has the molecular formula C42H30N4O2S4
and a molecular weight of 751.00 g/mol.
Molecular Properties
| Compound Name | CID 164759097 |
| PubChem CID | 164759097 |
| Molecular Formula | C42H30N4O2S4 |
| Molecular Weight | 751.00 g/mol |
| Exact Mass | 750.13 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C/c1ccc(-c2cc3c(s2)-c2cc4c(cc2OC32CCCCC2)-c2sc(-c3ccc(C=C(C#N)C#N)s3)cc2C2(CCCCC2)O4)s1 |
| InChI | InChI=1S/C42H30N4O2S4/c1-46-26(24-45)17-28-9-11-36(50-28)38-21-32-40(52-38)30-19-33-29(18-34(30)48-42(32)14-6-3-7-15-42)39-31(41(47-33)12-4-2-5-13-41)20-37(51-39)35-10-8-27(49-35)16-25(22-43)23-44/h8-11,16-21H,2-7,12-15H2/b26-17+ |
| InChIKey | NGMRIHJMTUXXPM-YZSQISJMSA-N |
| XLogP | 12.92 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 751.00 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 164759097 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164759097?
The IUPAC name of CID 164759097 (CID 164759097) is not available.
What is the SMILES notation for CID 164759097?
The canonical SMILES for CID 164759097 is [C-]#[N+]/C(C#N)=C/c1ccc(-c2cc3c(s2)-c2cc4c(cc2OC32CCCCC2)-c2sc(-c3ccc(C=C(C#N)C#N)s3)cc2C2(CCCCC2)O4)s1.
What is the InChIKey of CID 164759097?
The InChIKey is NGMRIHJMTUXXPM-YZSQISJMSA-N. The full InChI is InChI=1S/C42H30N4O2S4/c1-46-26(24-45)17-28-9-11-36(50-28)38-21-32-40(52-38)30-19-33-29(18-34(30)48-42(32)14-6-3-7-15-42)39-31(41(47-33)12-4-2-5-13-41)20-37(51-39)35-10-8-27(49-35)16-25(22-43)23-44/h8-11,16-21H,2-7,12-15H2/b26-17+.
What are the key properties of CID 164759097?
CID 164759097 has a molecular weight of 751.00 g/mol, XLogP of 12.92, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164759097 is sourced from PubChem (CID 164759097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).