About CID 167051213
CID 167051213 (PubChem CID 167051213) has the molecular formula C44H34N4O4S4
and a molecular weight of 811.05 g/mol.
Molecular Properties
| Compound Name | CID 167051213 |
| PubChem CID | 167051213 |
| Molecular Formula | C44H34N4O4S4 |
| Molecular Weight | 811.05 g/mol |
| Exact Mass | 810.15 |
| IUPAC Name | — |
| SMILES | COc1cc(C=C(C#N)C#N)sc1-c1cc2c(s1)-c1cc3c(cc1OC21CCCCC1)-c1sc(-c2sc(C=C(C#N)C#N)cc2OC)cc1C1(CCCCC1)O3 |
| InChI | InChI=1S/C44H34N4O4S4/c1-49-35-15-27(13-25(21-45)22-46)53-41(35)37-19-31-39(55-37)29-17-34-30(18-33(29)51-43(31)9-5-3-6-10-43)40-32(44(52-34)11-7-4-8-12-44)20-38(56-40)42-36(50-2)16-28(54-42)14-26(23-47)24-48/h13-20H,3-12H2,1-2H3 |
| InChIKey | VGWCFZCLIYEVNN-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 132.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 811.05 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 167051213 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167051213?
The IUPAC name of CID 167051213 (CID 167051213) is not available.
What is the SMILES notation for CID 167051213?
The canonical SMILES for CID 167051213 is COc1cc(C=C(C#N)C#N)sc1-c1cc2c(s1)-c1cc3c(cc1OC21CCCCC1)-c1sc(-c2sc(C=C(C#N)C#N)cc2OC)cc1C1(CCCCC1)O3.
What is the InChIKey of CID 167051213?
The InChIKey is VGWCFZCLIYEVNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H34N4O4S4/c1-49-35-15-27(13-25(21-45)22-46)53-41(35)37-19-31-39(55-37)29-17-34-30(18-33(29)51-43(31)9-5-3-6-10-43)40-32(44(52-34)11-7-4-8-12-44)20-38(56-40)42-36(50-2)16-28(54-42)14-26(23-47)24-48/h13-20H,3-12H2,1-2H3.
What are the key properties of CID 167051213?
CID 167051213 has a molecular weight of 811.05 g/mol, XLogP of 12.58, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167051213 is sourced from PubChem (CID 167051213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).