C46H40N4O2S5 — CID 164765000
CID 164765000 (PubChem CID 164765000) has the molecular formula C46H40N4O2S5 and a molecular weight of 841.19 g/mol.
| Compound Name | CID 164765000 |
|---|---|
| PubChem CID | 164765000 |
| Molecular Formula | C46H40N4O2S5 |
| Molecular Weight | 841.19 g/mol |
| Exact Mass | 840.18 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C/c1cc(OCCC)c(C2=Cc3sc4c5c(sc4c3C23CCCCC3)-c2sc(-c3sc(C=C(C#N)C#N)cc3OCCC)cc2C52CCCCC2)s1 |
| InChI | InChI=1S/C46H40N4O2S5/c1-4-16-51-33-21-30(19-28(26-49)50-3)53-39(33)31-22-35-37(45(31)12-8-6-9-13-45)42-44(55-35)38-43(57-42)40-32(46(38)14-10-7-11-15-46)23-36(56-40)41-34(52-17-5-2)20-29(54-41)18-27(24-47)25-48/h18-23H,4-17H2,1-2H3/b28-19+ |
| InChIKey | XYQHHXYWFAYVKL-TURZUDJPSA-N |
| XLogP | 14.59 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.19 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|