About CID 164765000
CID 164765000 (PubChem CID 164765000) has the molecular formula C46H40N4O2S5
and a molecular weight of 841.19 g/mol.
Molecular Properties
| Compound Name | CID 164765000 |
| PubChem CID | 164765000 |
| Molecular Formula | C46H40N4O2S5 |
| Molecular Weight | 841.19 g/mol |
| Exact Mass | 840.18 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C/c1cc(OCCC)c(C2=Cc3sc4c5c(sc4c3C23CCCCC3)-c2sc(-c3sc(C=C(C#N)C#N)cc3OCCC)cc2C52CCCCC2)s1 |
| InChI | InChI=1S/C46H40N4O2S5/c1-4-16-51-33-21-30(19-28(26-49)50-3)53-39(33)31-22-35-37(45(31)12-8-6-9-13-45)42-44(55-35)38-43(57-42)40-32(46(38)14-10-7-11-15-46)23-36(56-40)41-34(52-17-5-2)20-29(54-41)18-27(24-47)25-48/h18-23H,4-17H2,1-2H3/b28-19+ |
| InChIKey | XYQHHXYWFAYVKL-TURZUDJPSA-N |
| XLogP | 14.59 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 841.19 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 164765000 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164765000?
The IUPAC name of CID 164765000 (CID 164765000) is not available.
What is the SMILES notation for CID 164765000?
The canonical SMILES for CID 164765000 is [C-]#[N+]/C(C#N)=C/c1cc(OCCC)c(C2=Cc3sc4c5c(sc4c3C23CCCCC3)-c2sc(-c3sc(C=C(C#N)C#N)cc3OCCC)cc2C52CCCCC2)s1.
What is the InChIKey of CID 164765000?
The InChIKey is XYQHHXYWFAYVKL-TURZUDJPSA-N. The full InChI is InChI=1S/C46H40N4O2S5/c1-4-16-51-33-21-30(19-28(26-49)50-3)53-39(33)31-22-35-37(45(31)12-8-6-9-13-45)42-44(55-35)38-43(57-42)40-32(46(38)14-10-7-11-15-46)23-36(56-40)41-34(52-17-5-2)20-29(54-41)18-27(24-47)25-48/h18-23H,4-17H2,1-2H3/b28-19+.
What are the key properties of CID 164765000?
CID 164765000 has a molecular weight of 841.19 g/mol, XLogP of 14.59, 10 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164765000 is sourced from PubChem (CID 164765000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).