About CID 164758915
CID 164758915 (PubChem CID 164758915) has the molecular formula C42H28N4O2S6
and a molecular weight of 813.11 g/mol.
Molecular Properties
| Compound Name | CID 164758915 |
| PubChem CID | 164758915 |
| Molecular Formula | C42H28N4O2S6 |
| Molecular Weight | 813.11 g/mol |
| Exact Mass | 812.05 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(-c2cc3c(s2)-c2sc4c5c(sc4c2OC32CCCCC2)-c2sc(-c3ccc(/C=C(\C#N)[N+]#[C-])s3)cc2C2(CCCCC2)O5)s1 |
| InChI | InChI=1S/C42H28N4O2S6/c1-45-23(21-43)17-25-9-11-29(49-25)31-19-27-35(51-31)37-33(47-41(27)13-5-3-6-14-41)39-40(53-37)34-38(54-39)36-28(42(48-34)15-7-4-8-16-42)20-32(52-36)30-12-10-26(50-30)18-24(22-44)46-2/h9-12,17-20H,3-8,13-16H2/b23-17-,24-18+ |
| InChIKey | OWUZAYLISKONNO-QFFDILLMSA-N |
| XLogP | 14.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 813.11 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 164758915 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164758915?
The IUPAC name of CID 164758915 (CID 164758915) is not available.
What is the SMILES notation for CID 164758915?
The canonical SMILES for CID 164758915 is [C-]#[N+]/C(C#N)=C\c1ccc(-c2cc3c(s2)-c2sc4c5c(sc4c2OC32CCCCC2)-c2sc(-c3ccc(/C=C(\C#N)[N+]#[C-])s3)cc2C2(CCCCC2)O5)s1.
What is the InChIKey of CID 164758915?
The InChIKey is OWUZAYLISKONNO-QFFDILLMSA-N. The full InChI is InChI=1S/C42H28N4O2S6/c1-45-23(21-43)17-25-9-11-29(49-25)31-19-27-35(51-31)37-33(47-41(27)13-5-3-6-14-41)39-40(53-37)34-38(54-39)36-28(42(48-34)15-7-4-8-16-42)20-32(52-36)30-12-10-26(50-30)18-24(22-44)46-2/h9-12,17-20H,3-8,13-16H2/b23-17-,24-18+.
What are the key properties of CID 164758915?
CID 164758915 has a molecular weight of 813.11 g/mol, XLogP of 14.55, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164758915 is sourced from PubChem (CID 164758915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).