C42H28N4O2S6 — CID 164758915
CID 164758915 (PubChem CID 164758915) has the molecular formula C42H28N4O2S6 and a molecular weight of 813.11 g/mol.
| Compound Name | CID 164758915 |
|---|---|
| PubChem CID | 164758915 |
| Molecular Formula | C42H28N4O2S6 |
| Molecular Weight | 813.11 g/mol |
| Exact Mass | 812.05 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]/C(C#N)=C\c1ccc(-c2cc3c(s2)-c2sc4c5c(sc4c2OC32CCCCC2)-c2sc(-c3ccc(/C=C(\C#N)[N+]#[C-])s3)cc2C2(CCCCC2)O5)s1 |
| InChI | InChI=1S/C42H28N4O2S6/c1-45-23(21-43)17-25-9-11-29(49-25)31-19-27-35(51-31)37-33(47-41(27)13-5-3-6-14-41)39-40(53-37)34-38(54-39)36-28(42(48-34)15-7-4-8-16-42)20-32(52-36)30-12-10-26(50-30)18-24(22-44)46-2/h9-12,17-20H,3-8,13-16H2/b23-17-,24-18+ |
| InChIKey | OWUZAYLISKONNO-QFFDILLMSA-N |
| XLogP | 14.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.11 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|