C40H28N6S4 — CID 164759490
CID 164759490 (PubChem CID 164759490) has the molecular formula C40H28N6S4 and a molecular weight of 720.97 g/mol.
| Compound Name | CID 164759490 |
|---|---|
| PubChem CID | 164759490 |
| Molecular Formula | C40H28N6S4 |
| Molecular Weight | 720.97 g/mol |
| Exact Mass | 720.13 |
| IUPAC Name | — |
| SMILES | N#CC(C#N)=Cc1ccc(-c2nc3c(s2)-c2cc4c(cc2C32CCCCC2)-c2sc(-c3ccc(C=C(C#N)C#N)s3)nc2C42CCCCC2)s1 |
| InChI | InChI=1S/C40H28N6S4/c41-19-23(20-42)15-25-7-9-31(47-25)37-45-35-33(49-37)27-18-30-28(17-29(27)39(35)11-3-1-4-12-39)34-36(40(30)13-5-2-6-14-40)46-38(50-34)32-10-8-26(48-32)16-24(21-43)22-44/h7-10,15-18H,1-6,11-14H2 |
| InChIKey | SCBAJISISZURLR-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.97 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|