C38H36N2O4S6 — CID 164759750
CID 164759750 (PubChem CID 164759750) has the molecular formula C38H36N2O4S6 and a molecular weight of 777.12 g/mol.
| Compound Name | CID 164759750 |
|---|---|
| PubChem CID | 164759750 |
| Molecular Formula | C38H36N2O4S6 |
| Molecular Weight | 777.12 g/mol |
| Exact Mass | 776.10 |
| IUPAC Name | — |
| SMILES | CCN1C(=O)/C(=C\c2cc3c(s2)-c2cc4c(cc2C2(CCCCC2)O3)-c2sc(/C=C3/SC(=S)N(CC)C3=O)cc2OC42CCCCC2)SC1=S |
| InChI | InChI=1S/C38H36N2O4S6/c1-3-39-33(41)29(49-35(39)45)17-21-15-27-31(47-21)23-19-26-24(20-25(23)37(43-27)11-7-5-8-12-37)32-28(44-38(26)13-9-6-10-14-38)16-22(48-32)18-30-34(42)40(4-2)36(46)50-30/h15-20H,3-14H2,1-2H3/b29-17+,30-18+ |
| InChIKey | ODHQHBNYTLSKGV-YAGSLNJISA-N |
| XLogP | 10.69 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.12 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|