C46H50N2OS4 — CID 167064191
CID 167064191 (PubChem CID 167064191) has the molecular formula C46H50N2OS4 and a molecular weight of 775.19 g/mol.
| Compound Name | CID 167064191 |
|---|---|
| PubChem CID | 167064191 |
| Molecular Formula | C46H50N2OS4 |
| Molecular Weight | 775.19 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | — |
| SMILES | CCN1CS/C(=C\C2=Cc3cc4c(cc3C23CCCCC3)-c2cc3c(cc2C42CCCCC2)C=C(/C=C2\SC(=S)N(CC)C2=O)C32CCCCC2)C1=S |
| InChI | InChI=1S/C46H50N2OS4/c1-3-47-28-52-40(42(47)50)25-32-21-30-23-38-34(27-36(30)45(32)16-10-6-11-17-45)33-26-35-29(22-37(33)46(38)18-12-7-13-19-46)20-31(44(35)14-8-5-9-15-44)24-39-41(49)48(4-2)43(51)53-39/h20-27H,3-19,28H2,1-2H3/b39-24-,40-25- |
| InChIKey | RINDFWCUIWOMQN-CECRKRGCSA-N |
| XLogP | 12.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.19 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|