C36H34N2O2S7 — CID 164759013
CID 164759013 (PubChem CID 164759013) has the molecular formula C36H34N2O2S7 and a molecular weight of 751.15 g/mol.
| Compound Name | CID 164759013 |
|---|---|
| PubChem CID | 164759013 |
| Molecular Formula | C36H34N2O2S7 |
| Molecular Weight | 751.15 g/mol |
| Exact Mass | 750.07 |
| IUPAC Name | — |
| SMILES | CCN1C(=O)/C(=C/c2cc3c(s2)-c2sc4c(c2C32CCCCC2)C2(CCCCC2)c2cc(/C=C3\SC(=S)N(CC)C3=O)sc2-4)SC1=S |
| InChI | InChI=1S/C36H34N2O2S7/c1-3-37-31(39)23(45-33(37)41)17-19-15-21-27(43-19)29-25(35(21)11-7-5-8-12-35)26-30(47-29)28-22(36(26)13-9-6-10-14-36)16-20(44-28)18-24-32(40)38(4-2)34(42)46-24/h15-18H,3-14H2,1-2H3/b23-17-,24-18- |
| InChIKey | NQQFGUMKNOHHMN-BOYKQRMESA-N |
| XLogP | 10.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.15 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|