C13H21N3 — CID 164761899
3,4-ditert-butyl-5-isocyano-1-methylpyrazole (PubChem CID 164761899) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3,4-ditert-butyl-5-isocyano-1-methylpyrazole.
| Compound Name | 3,4-ditert-butyl-5-isocyano-1-methylpyrazole |
|---|---|
| PubChem CID | 164761899 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3,4-ditert-butyl-5-isocyano-1-methylpyrazole |
| SMILES | [C-]#[N+]c1c(C(C)(C)C)c(C(C)(C)C)nn1C |
| InChI | InChI=1S/C13H21N3/c1-12(2,3)9-10(13(4,5)6)15-16(8)11(9)14-7/h1-6,8H3 |
| InChIKey | SDBMWMKIPWXGFY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|