C12H21FN2 — CID 176827799
4,5-ditert-butyl-3-fluoro-1-methylpyrazole (PubChem CID 176827799) has the molecular formula C12H21FN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is 4,5-ditert-butyl-3-fluoro-1-methylpyrazole.
| Compound Name | 4,5-ditert-butyl-3-fluoro-1-methylpyrazole |
|---|---|
| PubChem CID | 176827799 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 4,5-ditert-butyl-3-fluoro-1-methylpyrazole |
| SMILES | Cn1nc(F)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C12H21FN2/c1-11(2,3)8-9(12(4,5)6)15(7)14-10(8)13/h1-7H3 |
| InChIKey | JORDCOPBEOQSOB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |