C15H28N2 — CID 154613443
4,5-ditert-butyl-3-methyl-1-propan-2-ylpyrazole (PubChem CID 154613443) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 4,5-ditert-butyl-3-methyl-1-propan-2-ylpyrazole.
| Compound Name | 4,5-ditert-butyl-3-methyl-1-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 154613443 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 4,5-ditert-butyl-3-methyl-1-propan-2-ylpyrazole |
| SMILES | Cc1nn(C(C)C)c(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C15H28N2/c1-10(2)17-13(15(7,8)9)12(11(3)16-17)14(4,5)6/h10H,1-9H3 |
| InChIKey | GDMOIEXITWDNEE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |