C15H27N3O2Si — CID 164762717
tert-butyl 3-trimethylsilyl-1,2,8-triazaspiro[4.5]deca-1,3-diene-8-carboxylate (PubChem CID 164762717) has the molecular formula C15H27N3O2Si and a molecular weight of 309.49 g/mol. Its IUPAC name is tert-butyl 3-trimethylsilyl-1,2,8-triazaspiro[4.5]deca-1,3-diene-8-carboxylate.
| Compound Name | tert-butyl 3-trimethylsilyl-1,2,8-triazaspiro[4.5]deca-1,3-diene-8-carboxylate |
|---|---|
| PubChem CID | 164762717 |
| Molecular Formula | C15H27N3O2Si |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl 3-trimethylsilyl-1,2,8-triazaspiro[4.5]deca-1,3-diene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C=C([Si](C)(C)C)N=N2)CC1 |
| InChI | InChI=1S/C15H27N3O2Si/c1-14(2,3)20-13(19)18-9-7-15(8-10-18)11-12(16-17-15)21(4,5)6/h11H,7-10H2,1-6H3 |
| InChIKey | BOXSSZAPJDDOKD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|