C52H47N2O3Pt- — CID 164772027
CID 164772027 (PubChem CID 164772027) has the molecular formula C52H47N2O3Pt- and a molecular weight of 943.04 g/mol.
| Compound Name | CID 164772027 |
|---|---|
| PubChem CID | 164772027 |
| Molecular Formula | C52H47N2O3Pt- |
| Molecular Weight | 943.04 g/mol |
| Exact Mass | 942.32 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2nc3c(-c4[c-]c(-c5cc(C6CCCCC6)ccn5)cc5c4oc4c6ccccc6c6ccccc6c54)cccc3o2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C52H47N2O3.Pt/c1-51(2,3)33-28-41(47(55)42(29-33)52(4,5)6)50-54-46-37(21-14-22-44(46)56-50)39-25-32(43-27-31(23-24-53-43)30-15-8-7-9-16-30)26-40-45-36-19-12-10-17-34(36)35-18-11-13-20-38(35)49(45)57-48(39)40;/h10-14,17-24,26-30,55H,7-9,15-16H2,1-6H3;/q-1; |
| InChIKey | SDWWHJUVNMXPQA-UHFFFAOYSA-N |
| XLogP | 14.58 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.04 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|