C29H16F3N2O2Pt- — CID 177110673
platinum;2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol (PubChem CID 177110673) has the molecular formula C29H16F3N2O2Pt- and a molecular weight of 676.53 g/mol. Its IUPAC name is platinum;2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol.
| Compound Name | platinum;2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol |
|---|---|
| PubChem CID | 177110673 |
| Molecular Formula | C29H16F3N2O2Pt- |
| Molecular Weight | 676.53 g/mol |
| Exact Mass | 676.08 |
| IUPAC Name | platinum;2-[4-[3-[6-(trifluoromethyl)quinolin-8-yl]benzene-2-id-1-yl]-1,3-benzoxazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc2c(-c3[c-]c(-c4cc(C(F)(F)F)cc5cccnc45)ccc3)cccc2o1.[Pt] |
| InChI | InChI=1S/C29H16F3N2O2.Pt/c30-29(31,32)20-15-19-8-5-13-33-26(19)23(16-20)18-7-3-6-17(14-18)21-10-4-12-25-27(21)34-28(36-25)22-9-1-2-11-24(22)35;/h1-13,15-16,35H;/q-1; |
| InChIKey | KVHNRAHFPBYIEU-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.53 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|