C48H39N2O3Pt- — CID 164772054
2,4-ditert-butyl-6-[4-[8-(4-phenyl-2-pyridinyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]-1,3-benzoxazol-2-yl]phenol;platinum (PubChem CID 164772054) has the molecular formula C48H39N2O3Pt- and a molecular weight of 886.93 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[4-[8-(4-phenyl-2-pyridinyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]-1,3-benzoxazol-2-yl]phenol;platinum.
| Compound Name | 2,4-ditert-butyl-6-[4-[8-(4-phenyl-2-pyridinyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 164772054 |
| Molecular Formula | C48H39N2O3Pt- |
| Molecular Weight | 886.93 g/mol |
| Exact Mass | 886.26 |
| IUPAC Name | 2,4-ditert-butyl-6-[4-[8-(4-phenyl-2-pyridinyl)-9H-naphtho[1,2-b][1]benzofuran-9-id-10-yl]-1,3-benzoxazol-2-yl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc3c(-c4[c-]c(-c5cc(-c6ccccc6)ccn5)cc5c4oc4c6ccccc6ccc54)cccc3o2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C48H39N2O3.Pt/c1-47(2,3)32-26-38(43(51)39(27-32)48(4,5)6)46-50-42-34(17-12-18-41(42)52-46)36-23-31(40-25-30(21-22-49-40)28-13-8-7-9-14-28)24-37-35-20-19-29-15-10-11-16-33(29)44(35)53-45(36)37;/h7-22,24-27,51H,1-6H3;/q-1; |
| InChIKey | WPWUPKGDRPMSMA-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.93 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|