C32H22N2O — CID 164778402
10-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6H-benzimidazolo[2,1-c][1,4]benzoxazine (PubChem CID 164778402) has the molecular formula C32H22N2O and a molecular weight of 460.60 g/mol. Its IUPAC name is 10-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6H-benzimidazolo[2,1-c][1,4]benzoxazine.
| Compound Name | 10-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6H-benzimidazolo[2,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 164778402 |
| Molecular Formula | C32H22N2O |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 10-[2,6-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-6H-benzimidazolo[2,1-c][1,4]benzoxazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-c2ccc3nc4n(c3c2)-c2ccccc2OC4)c([2H])c1[2H] |
| InChI | InChI=1S/C32H22N2O/c1-3-10-22(11-4-1)25-14-9-15-26(23-12-5-2-6-13-23)32(25)24-18-19-27-29(20-24)34-28-16-7-8-17-30(28)35-21-31(34)33-27/h1-20H,21H2/i1D,2D,3D,4D,5D,6D,10D,11D,12D,13D |
| InChIKey | JDKMSZRDIGGTCT-KJIKOLQBSA-N |
| XLogP | 7.92 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |