C43H28N2 — CID 169070720
1-[2-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole (PubChem CID 169070720) has the molecular formula C43H28N2 and a molecular weight of 577.74 g/mol. Its IUPAC name is 1-[2-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole.
| Compound Name | 1-[2-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
|---|---|
| PubChem CID | 169070720 |
| Molecular Formula | C43H28N2 |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 1-[2-(10-naphthalen-2-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc3ccccc3n2-c2ccccc2-c2c3ccccc3c(-c3ccc4ccccc4c3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C43H28N2/c1-2-15-30(16-3-1)43-44-38-23-11-13-25-40(38)45(43)39-24-12-10-22-37(39)42-35-20-8-6-18-33(35)41(34-19-7-9-21-36(34)42)32-27-26-29-14-4-5-17-31(29)28-32/h1-28H/i1D,2D,3D,15D,16D |
| InChIKey | IPNVMBBUSOFQQY-NVQYRDKCSA-N |
| XLogP | 11.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|