C47H30N2 — CID 169070654
1-naphthalen-1-yl-2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]benzimidazole (PubChem CID 169070654) has the molecular formula C47H30N2 and a molecular weight of 630.82 g/mol. Its IUPAC name is 1-naphthalen-1-yl-2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]benzimidazole.
| Compound Name | 1-naphthalen-1-yl-2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 169070654 |
| Molecular Formula | C47H30N2 |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | 1-naphthalen-1-yl-2-[4-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4ccccc4c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4nc5ccccc5n4-c4cccc5ccccc45)cc3)c2c1[2H] |
| InChI | InChI=1S/C47H30N2/c1-2-14-35-30-36(29-24-31(35)12-1)46-40-19-7-5-17-38(40)45(39-18-6-8-20-41(39)46)33-25-27-34(28-26-33)47-48-42-21-9-10-22-44(42)49(47)43-23-11-15-32-13-3-4-16-37(32)43/h1-30H/i5D,6D,7D,8D,17D,18D,19D,20D |
| InChIKey | POLBUOUWXCZLJV-LJHRBXIWSA-N |
| XLogP | 12.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|