C49H32N2 — CID 169070688
2-[4-[1,3,4,5,6,7,8-heptadeuterio-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-2-yl]phenyl]-1-naphthalen-1-ylbenzimidazole (PubChem CID 169070688) has the molecular formula C49H32N2 and a molecular weight of 665.91 g/mol. Its IUPAC name is 2-[4-[1,3,4,5,6,7,8-heptadeuterio-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-2-yl]phenyl]-1-naphthalen-1-ylbenzimidazole.
| Compound Name | 2-[4-[1,3,4,5,6,7,8-heptadeuterio-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-2-yl]phenyl]-1-naphthalen-1-ylbenzimidazole |
|---|---|
| PubChem CID | 169070688 |
| Molecular Formula | C49H32N2 |
| Molecular Weight | 665.91 g/mol |
| Exact Mass | 665.36 |
| IUPAC Name | 2-[4-[1,3,4,5,6,7,8-heptadeuterio-9,10-bis(2,3,4,5,6-pentadeuteriophenyl)anthracen-2-yl]phenyl]-1-naphthalen-1-ylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3c([2H])c([2H])c([2H])c([2H])c3c(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3c([2H])c(-c4ccc(-c5nc6ccccc6n5-c5cccc6ccccc56)cc4)c([2H])c([2H])c23)c([2H])c1[2H] |
| InChI | InChI=1S/C49H32N2/c1-3-15-35(16-4-1)47-40-21-9-10-22-41(40)48(36-17-5-2-6-18-36)43-32-38(30-31-42(43)47)33-26-28-37(29-27-33)49-50-44-23-11-12-24-46(44)51(49)45-25-13-19-34-14-7-8-20-39(34)45/h1-32H/i1D,2D,3D,4D,5D,6D,9D,10D,15D,16D,17D,18D,21D,22D,30D,31D,32D |
| InChIKey | ATMBYVGQQLYWSK-WDEDHSJRSA-N |
| XLogP | 13.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.91 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|