C47H30N2 — CID 169070496
2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(10-phenanthren-9-ylanthracen-9-yl)phenyl]benzimidazole (PubChem CID 169070496) has the molecular formula C47H30N2 and a molecular weight of 627.80 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(10-phenanthren-9-ylanthracen-9-yl)phenyl]benzimidazole.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(10-phenanthren-9-ylanthracen-9-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 169070496 |
| Molecular Formula | C47H30N2 |
| Molecular Weight | 627.80 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[2-(10-phenanthren-9-ylanthracen-9-yl)phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc3ccccc3n2-c2ccccc2-c2c3ccccc3c(-c3cc4ccccc4c4ccccc34)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C47H30N2/c1-2-16-31(17-3-1)47-48-42-27-13-15-29-44(42)49(47)43-28-14-12-26-40(43)45-36-22-8-10-24-38(36)46(39-25-11-9-23-37(39)45)41-30-32-18-4-5-19-33(32)34-20-6-7-21-35(34)41/h1-30H/i1D,2D,3D,16D,17D |
| InChIKey | ANWXKJJOHRVWHF-BDNQOSTESA-N |
| XLogP | 12.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.80 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|