C34H23N5 — CID 176879180
1-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzimidazole (PubChem CID 176879180) has the molecular formula C34H23N5 and a molecular weight of 511.65 g/mol. Its IUPAC name is 1-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzimidazole.
| Compound Name | 1-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzimidazole |
|---|---|
| PubChem CID | 176879180 |
| Molecular Formula | C34H23N5 |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 1-[2-[4,6-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-2-phenylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3-n3c(-c4ccccc4)nc4ccccc43)nc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C34H23N5/c1-4-14-24(15-5-1)31-36-32(25-16-6-2-7-17-25)38-33(37-31)27-20-10-12-22-29(27)39-30-23-13-11-21-28(30)35-34(39)26-18-8-3-9-19-26/h1-23H/i1D,2D,4D,5D,6D,7D,14D,15D,16D,17D |
| InChIKey | DBCOFTHFORHHIE-RIMVHXCBSA-N |
| XLogP | 7.88 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |