C13H16Br2N4O2 — CID 164780080
tert-butyl (3S)-3-(3,5-dibromo-4-isocyanopyrazol-1-yl)pyrrolidine-1-carboxylate (PubChem CID 164780080) has the molecular formula C13H16Br2N4O2 and a molecular weight of 420.11 g/mol. Its IUPAC name is tert-butyl (3S)-3-(3,5-dibromo-4-isocyanopyrazol-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(3,5-dibromo-4-isocyanopyrazol-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164780080 |
| Molecular Formula | C13H16Br2N4O2 |
| Molecular Weight | 420.11 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | tert-butyl (3S)-3-(3,5-dibromo-4-isocyanopyrazol-1-yl)pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(Br)nn([C@H]2CCN(C(=O)OC(C)(C)C)C2)c1Br |
| InChI | InChI=1S/C13H16Br2N4O2/c1-13(2,3)21-12(20)18-6-5-8(7-18)19-11(15)9(16-4)10(14)17-19/h8H,5-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | KIBOFSGYRHBEGB-QMMMGPOBSA-N |
| XLogP | 4.14 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.11 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|