C23H35N5O4Si — CID 164780253
tert-butyl 3-[4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-trimethylsilylethynyl)pyrazol-1-yl]azetidine-1-carboxylate (PubChem CID 164780253) has the molecular formula C23H35N5O4Si and a molecular weight of 473.65 g/mol. Its IUPAC name is tert-butyl 3-[4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-trimethylsilylethynyl)pyrazol-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-trimethylsilylethynyl)pyrazol-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164780253 |
| Molecular Formula | C23H35N5O4Si |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | tert-butyl 3-[4-isocyano-5-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-trimethylsilylethynyl)pyrazol-1-yl]azetidine-1-carboxylate |
| SMILES | [C-]#[N+]c1c(C#C[Si](C)(C)C)nn(C2CN(C(=O)OC(C)(C)C)C2)c1N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H35N5O4Si/c1-22(2,3)31-20(29)26(8)19-18(24-7)17(12-13-33(9,10)11)25-28(19)16-14-27(15-16)21(30)32-23(4,5)6/h16H,14-15H2,1-6,8-11H3 |
| InChIKey | QPLQKUGYDWQEAP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 81.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|