C32H35N5O4 — CID 164782942
tert-butyl 5-benzyl-11-cyclopropyl-7-[4-(methylcarbamoyl)phenyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate (PubChem CID 164782942) has the molecular formula C32H35N5O4 and a molecular weight of 553.66 g/mol. Its IUPAC name is tert-butyl 5-benzyl-11-cyclopropyl-7-[4-(methylcarbamoyl)phenyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate.
| Compound Name | tert-butyl 5-benzyl-11-cyclopropyl-7-[4-(methylcarbamoyl)phenyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 164782942 |
| Molecular Formula | C32H35N5O4 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | tert-butyl 5-benzyl-11-cyclopropyl-7-[4-(methylcarbamoyl)phenyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-12-carboxylate |
| SMILES | CNC(=O)c1ccc(-n2c(=O)c3c(n4ncc(Cc5ccccc5)c24)CN(C(=O)OC(C)(C)C)C(C2CC2)C3)cc1 |
| InChI | InChI=1S/C32H35N5O4/c1-32(2,3)41-31(40)35-19-27-25(17-26(35)21-10-11-21)30(39)36(24-14-12-22(13-15-24)28(38)33-4)29-23(18-34-37(27)29)16-20-8-6-5-7-9-20/h5-9,12-15,18,21,26H,10-11,16-17,19H2,1-4H3,(H,33,38) |
| InChIKey | GFISCPWFQZLGIV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |