C30H31F5NS2+ — CID 164783305
[5-(2,2-dimethylpropyl)-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-12-yl]-pentafluoro-λ6-sulfane (PubChem CID 164783305) has the molecular formula C30H31F5NS2+ and a molecular weight of 564.71 g/mol. Its IUPAC name is [5-(2,2-dimethylpropyl)-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-12-yl]-pentafluoro-λ6-sulfane.
| Compound Name | [5-(2,2-dimethylpropyl)-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-12-yl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 164783305 |
| Molecular Formula | C30H31F5NS2+ |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [5-(2,2-dimethylpropyl)-14-methyl-15-(2,3,5-trimethylphenyl)-17-thia-14-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaen-12-yl]-pentafluoro-λ6-sulfane |
| SMILES | Cc1cc(C)c(C)c(-c2c3sc4c5ccc(CC(C)(C)C)cc5ccc4c3c(S(F)(F)(F)(F)F)c[n+]2C)c1 |
| InChI | InChI=1S/C30H31F5NS2/c1-17-12-18(2)19(3)24(13-17)27-29-26(25(16-36(27)7)38(31,32,33,34)35)23-11-9-21-14-20(15-30(4,5)6)8-10-22(21)28(23)37-29/h8-14,16H,15H2,1-7H3/q+1 |
| InChIKey | ZWKORHNVUJJRSD-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|