C24H34N4O12 — CID 164786158
1-O-[2-(2-oxoimidazolidin-1-yl)ethyl] 4-O-[2-[2-[2-[(Z)-4-oxo-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]but-2-enoyl]oxyethoxy]ethoxy]ethyl] (Z)-but-2-enedioate (PubChem CID 164786158) has the molecular formula C24H34N4O12 and a molecular weight of 570.55 g/mol. Its IUPAC name is 1-O-[2-(2-oxoimidazolidin-1-yl)ethyl] 4-O-[2-[2-[2-[(Z)-4-oxo-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]but-2-enoyl]oxyethoxy]ethoxy]ethyl] (Z)-but-2-enedioate.
| Compound Name | 1-O-[2-(2-oxoimidazolidin-1-yl)ethyl] 4-O-[2-[2-[2-[(Z)-4-oxo-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]but-2-enoyl]oxyethoxy]ethoxy]ethyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 164786158 |
| Molecular Formula | C24H34N4O12 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 1-O-[2-(2-oxoimidazolidin-1-yl)ethyl] 4-O-[2-[2-[2-[(Z)-4-oxo-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]but-2-enoyl]oxyethoxy]ethoxy]ethyl] (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)OCCN1CCNC1=O)OCCOCCOCCOC(=O)/C=C\C(=O)OCCN1CCNC1=O |
| InChI | InChI=1S/C24H34N4O12/c29-19(37-11-9-27-7-5-25-23(27)33)1-3-21(31)39-17-15-35-13-14-36-16-18-40-22(32)4-2-20(30)38-12-10-28-8-6-26-24(28)34/h1-4H,5-18H2,(H,25,33)(H,26,34)/b3-1-,4-2- |
| InChIKey | HIWMUIGPRIVIQT-CCAGOZQPSA-N |
| XLogP | -1.64 |
| TPSA | 188.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|