C54H34O — CID 164787467
6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-phenyl-3-[1,2,3,4-tetradeuterio-10-(3-naphthalen-2-ylphenyl)anthracen-9-yl]-1-benzofuran (PubChem CID 164787467) has the molecular formula C54H34O and a molecular weight of 709.93 g/mol. Its IUPAC name is 6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-phenyl-3-[1,2,3,4-tetradeuterio-10-(3-naphthalen-2-ylphenyl)anthracen-9-yl]-1-benzofuran.
| Compound Name | 6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-phenyl-3-[1,2,3,4-tetradeuterio-10-(3-naphthalen-2-ylphenyl)anthracen-9-yl]-1-benzofuran |
|---|---|
| PubChem CID | 164787467 |
| Molecular Formula | C54H34O |
| Molecular Weight | 709.93 g/mol |
| Exact Mass | 709.33 |
| IUPAC Name | 6-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)-2-phenyl-3-[1,2,3,4-tetradeuterio-10-(3-naphthalen-2-ylphenyl)anthracen-9-yl]-1-benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3ccc4c(-c5c6ccccc6c(-c6cccc(-c7ccc8ccccc8c7)c6)c6c([2H])c([2H])c([2H])c([2H])c56)c(-c5ccccc5)oc4c3)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C54H34O/c1-2-15-37(16-3-1)54-53(49-30-29-43(34-50(49)55-54)42-28-26-36-14-5-7-18-39(36)32-42)52-47-23-10-8-21-45(47)51(46-22-9-11-24-48(46)52)44-20-12-19-40(33-44)41-27-25-35-13-4-6-17-38(35)31-41/h1-34H/i5D,7D,8D,10D,14D,18D,21D,23D,26D,28D,32D |
| InChIKey | AJSIGFVHARZDGX-UTVFWEIESA-N |
| XLogP | 15.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.93 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|