C24H36 — CID 164787659
[(2E,10E)-7-ethenylhexadeca-2,10-dien-5-yl]benzene (PubChem CID 164787659) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is [(2E,10E)-7-ethenylhexadeca-2,10-dien-5-yl]benzene.
| Compound Name | [(2E,10E)-7-ethenylhexadeca-2,10-dien-5-yl]benzene |
|---|---|
| PubChem CID | 164787659 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | [(2E,10E)-7-ethenylhexadeca-2,10-dien-5-yl]benzene |
| SMILES | C=CC(CC/C=C/CCCCC)CC(C/C=C/C)c1ccccc1 |
| InChI | InChI=1S/C24H36/c1-4-7-9-10-11-12-14-17-22(6-3)21-24(18-8-5-2)23-19-15-13-16-20-23/h5-6,8,11-13,15-16,19-20,22,24H,3-4,7,9-10,14,17-18,21H2,1-2H3/b8-5+,12-11+ |
| InChIKey | LCMREEXSFYKKMR-CQYWEGEGSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|