C48H31N3 — CID 164788572
9-[3-carbazol-9-yl-5-(2-carbazol-9-yl-3,4,5,6-tetradeuteriophenyl)-2,4,6-trideuteriophenyl]carbazole (PubChem CID 164788572) has the molecular formula C48H31N3 and a molecular weight of 656.84 g/mol. Its IUPAC name is 9-[3-carbazol-9-yl-5-(2-carbazol-9-yl-3,4,5,6-tetradeuteriophenyl)-2,4,6-trideuteriophenyl]carbazole.
| Compound Name | 9-[3-carbazol-9-yl-5-(2-carbazol-9-yl-3,4,5,6-tetradeuteriophenyl)-2,4,6-trideuteriophenyl]carbazole |
|---|---|
| PubChem CID | 164788572 |
| Molecular Formula | C48H31N3 |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | 9-[3-carbazol-9-yl-5-(2-carbazol-9-yl-3,4,5,6-tetradeuteriophenyl)-2,4,6-trideuteriophenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3ccccc3c3ccccc32)c(-c2c([2H])c(-n3c4ccccc4c4ccccc43)c([2H])c(-n3c4ccccc4c4ccccc43)c2[2H])c1[2H] |
| InChI | InChI=1S/C48H31N3/c1-8-22-42(51-47-27-13-6-20-40(47)41-21-7-14-28-48(41)51)35(15-1)32-29-33(49-43-23-9-2-16-36(43)37-17-3-10-24-44(37)49)31-34(30-32)50-45-25-11-4-18-38(45)39-19-5-12-26-46(39)50/h1-31H/i1D,8D,15D,22D,29D,30D,31D |
| InChIKey | VMWRVVZGUQMGLC-HVWXINRTSA-N |
| XLogP | 12.64 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |