C16H30O4 — CID 164792013
2-methyl-3-[2-[1-[2-(2-methylprop-2-enoxy)propoxy]propan-2-yloxy]ethoxy]prop-1-ene (PubChem CID 164792013) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 2-methyl-3-[2-[1-[2-(2-methylprop-2-enoxy)propoxy]propan-2-yloxy]ethoxy]prop-1-ene.
| Compound Name | 2-methyl-3-[2-[1-[2-(2-methylprop-2-enoxy)propoxy]propan-2-yloxy]ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 164792013 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 2-methyl-3-[2-[1-[2-(2-methylprop-2-enoxy)propoxy]propan-2-yloxy]ethoxy]prop-1-ene |
| SMILES | C=C(C)COCCOC(C)COCC(C)OCC(=C)C |
| InChI | InChI=1S/C16H30O4/c1-13(2)9-17-7-8-19-15(5)11-18-12-16(6)20-10-14(3)4/h15-16H,1,3,7-12H2,2,4-6H3 |
| InChIKey | IBRPYPMSQSNKER-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|