C23H23F3N4O4 — CID 164798507
[(3R)-4-amino-3-methyl-1,3,7,8-tetrahydrofuro[3,4-c][1,7]naphthyridin-8-yl]-[(3S)-3-[4-(trifluoromethoxy)phenyl]morpholin-4-yl]methanone (PubChem CID 164798507) has the molecular formula C23H23F3N4O4 and a molecular weight of 476.46 g/mol. Its IUPAC name is [(3R)-4-amino-3-methyl-1,3,7,8-tetrahydrofuro[3,4-c][1,7]naphthyridin-8-yl]-[(3S)-3-[4-(trifluoromethoxy)phenyl]morpholin-4-yl]methanone.
| Compound Name | [(3R)-4-amino-3-methyl-1,3,7,8-tetrahydrofuro[3,4-c][1,7]naphthyridin-8-yl]-[(3S)-3-[4-(trifluoromethoxy)phenyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 164798507 |
| Molecular Formula | C23H23F3N4O4 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [(3R)-4-amino-3-methyl-1,3,7,8-tetrahydrofuro[3,4-c][1,7]naphthyridin-8-yl]-[(3S)-3-[4-(trifluoromethoxy)phenyl]morpholin-4-yl]methanone |
| SMILES | C[C@H]1OCc2c1c(N)nc1c2=CC(C(=O)N2CCOC[C@@H]2c2ccc(OC(F)(F)F)cc2)NC=1 |
| InChI | InChI=1S/C23H23F3N4O4/c1-12-20-16(10-33-12)15-8-17(28-9-18(15)29-21(20)27)22(31)30-6-7-32-11-19(30)13-2-4-14(5-3-13)34-23(24,25)26/h2-5,8-9,12,17,19,28H,6-7,10-11H2,1H3,(H2,27,29)/t12-,17?,19-/m1/s1 |
| InChIKey | XZFDGDVYGGRDEI-AZOXIEDXSA-N |
| XLogP | 1.24 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |