C23H21F3N4O3 — CID 164798691
(4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(2,2,2-trifluoroethyl)phenyl]morpholin-4-yl]methanone (PubChem CID 164798691) has the molecular formula C23H21F3N4O3 and a molecular weight of 458.44 g/mol. Its IUPAC name is (4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(2,2,2-trifluoroethyl)phenyl]morpholin-4-yl]methanone.
| Compound Name | (4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(2,2,2-trifluoroethyl)phenyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 164798691 |
| Molecular Formula | C23H21F3N4O3 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (4-amino-1,3-dihydrofuro[3,4-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(2,2,2-trifluoroethyl)phenyl]morpholin-4-yl]methanone |
| SMILES | Nc1nc2cnc(C(=O)N3CCOC[C@@H]3c3ccc(CC(F)(F)F)cc3)cc2c2c1COC2 |
| InChI | InChI=1S/C23H21F3N4O3/c24-23(25,26)8-13-1-3-14(4-2-13)20-12-32-6-5-30(20)22(31)18-7-15-16-10-33-11-17(16)21(27)29-19(15)9-28-18/h1-4,7,9,20H,5-6,8,10-12H2,(H2,27,29)/t20-/m1/s1 |
| InChIKey | BQEFDNUNYUUTOP-HXUWFJFHSA-N |
| XLogP | 3.56 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |