C22H17F3N6O2 — CID 164798754
(5-aminopyrimido[4,5-c][1,7]naphthyridin-9-yl)-[(3S)-3-[4-(trifluoromethyl)phenyl]morpholin-4-yl]methanone (PubChem CID 164798754) has the molecular formula C22H17F3N6O2 and a molecular weight of 454.41 g/mol. Its IUPAC name is (5-aminopyrimido[4,5-c][1,7]naphthyridin-9-yl)-[(3S)-3-[4-(trifluoromethyl)phenyl]morpholin-4-yl]methanone.
| Compound Name | (5-aminopyrimido[4,5-c][1,7]naphthyridin-9-yl)-[(3S)-3-[4-(trifluoromethyl)phenyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 164798754 |
| Molecular Formula | C22H17F3N6O2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (5-aminopyrimido[4,5-c][1,7]naphthyridin-9-yl)-[(3S)-3-[4-(trifluoromethyl)phenyl]morpholin-4-yl]methanone |
| SMILES | Nc1nc2cnc(C(=O)N3CCOC[C@@H]3c3ccc(C(F)(F)F)cc3)cc2c2cncnc12 |
| InChI | InChI=1S/C22H17F3N6O2/c23-22(24,25)13-3-1-12(2-4-13)18-10-33-6-5-31(18)21(32)16-7-14-15-8-27-11-29-19(15)20(26)30-17(14)9-28-16/h1-4,7-9,11,18H,5-6,10H2,(H2,26,30)/t18-/m1/s1 |
| InChIKey | USHNOHORBFFMRW-GOSISDBHSA-N |
| XLogP | 3.39 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|