C23H21F5N6O2 — CID 164798558
N'-[4-(2-methylpyrazol-3-yl)-6-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholine-4-carbonyl]-3-pyridinyl]methanimidamide (PubChem CID 164798558) has the molecular formula C23H21F5N6O2 and a molecular weight of 508.45 g/mol. Its IUPAC name is N'-[4-(2-methylpyrazol-3-yl)-6-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholine-4-carbonyl]-3-pyridinyl]methanimidamide.
| Compound Name | N'-[4-(2-methylpyrazol-3-yl)-6-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholine-4-carbonyl]-3-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 164798558 |
| Molecular Formula | C23H21F5N6O2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N'-[4-(2-methylpyrazol-3-yl)-6-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholine-4-carbonyl]-3-pyridinyl]methanimidamide |
| SMILES | Cn1nccc1-c1cc(C(=O)N2CCOC[C@@H]2c2ccc(C(F)(F)C(F)(F)F)cc2)ncc1/N=C/N |
| InChI | InChI=1S/C23H21F5N6O2/c1-33-19(6-7-32-33)16-10-17(30-11-18(16)31-13-29)21(35)34-8-9-36-12-20(34)14-2-4-15(5-3-14)22(24,25)23(26,27)28/h2-7,10-11,13,20H,8-9,12H2,1H3,(H2,29,31)/t20-/m1/s1 |
| InChIKey | SRZIOGFMILPRPP-HXUWFJFHSA-N |
| XLogP | 3.97 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|