C23H19F5N6O2 — CID 164798709
(4-amino-1-methylpyrazolo[4,5-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholin-4-yl]methanone (PubChem CID 164798709) has the molecular formula C23H19F5N6O2 and a molecular weight of 506.44 g/mol. Its IUPAC name is (4-amino-1-methylpyrazolo[4,5-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholin-4-yl]methanone.
| Compound Name | (4-amino-1-methylpyrazolo[4,5-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 164798709 |
| Molecular Formula | C23H19F5N6O2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (4-amino-1-methylpyrazolo[4,5-c][1,7]naphthyridin-8-yl)-[(3S)-3-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]morpholin-4-yl]methanone |
| SMILES | Cn1ncc2c(N)nc3cnc(C(=O)N4CCOC[C@@H]4c4ccc(C(F)(F)C(F)(F)F)cc4)cc3c21 |
| InChI | InChI=1S/C23H19F5N6O2/c1-33-19-14-8-16(30-10-17(14)32-20(29)15(19)9-31-33)21(35)34-6-7-36-11-18(34)12-2-4-13(5-3-12)22(24,25)23(26,27)28/h2-5,8-10,18H,6-7,11H2,1H3,(H2,29,32)/t18-/m1/s1 |
| InChIKey | IHTPXXVHADFSGN-GOSISDBHSA-N |
| XLogP | 3.97 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|