C18H30O7S2 — CID 164799642
4-[5-[5-[(2-oxo-1,3-dioxolan-4-yl)methylsulfanyl]pentoxy]pentylsulfanylmethyl]-1,3-dioxolan-2-one (PubChem CID 164799642) has the molecular formula C18H30O7S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[5-[5-[(2-oxo-1,3-dioxolan-4-yl)methylsulfanyl]pentoxy]pentylsulfanylmethyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[5-[5-[(2-oxo-1,3-dioxolan-4-yl)methylsulfanyl]pentoxy]pentylsulfanylmethyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 164799642 |
| Molecular Formula | C18H30O7S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-[5-[5-[(2-oxo-1,3-dioxolan-4-yl)methylsulfanyl]pentoxy]pentylsulfanylmethyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CSCCCCCOCCCCCSCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C18H30O7S2/c19-17-22-11-15(24-17)13-26-9-5-1-3-7-21-8-4-2-6-10-27-14-16-12-23-18(20)25-16/h15-16H,1-14H2 |
| InChIKey | UQQUFUDLIZPXSU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|