C19H35N7O11P2 — CID 164801968
[(2R,3R,4R,5R)-5-[4-amino-2-[4-(diaminomethylideneamino)butylimino]pyrimidin-1-yl]-4-(oxan-2-yloxy)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 164801968) has the molecular formula C19H35N7O11P2 and a molecular weight of 599.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[4-amino-2-[4-(diaminomethylideneamino)butylimino]pyrimidin-1-yl]-4-(oxan-2-yloxy)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-[4-amino-2-[4-(diaminomethylideneamino)butylimino]pyrimidin-1-yl]-4-(oxan-2-yloxy)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 164801968 |
| Molecular Formula | C19H35N7O11P2 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[4-amino-2-[4-(diaminomethylideneamino)butylimino]pyrimidin-1-yl]-4-(oxan-2-yloxy)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | NC(N)=NCCCC/N=c1\nc(N)ccn1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C19H35N7O11P2/c20-13-6-9-26(19(25-13)24-8-3-2-7-23-18(21)22)17-16(36-14-5-1-4-10-33-14)15(37-39(30,31)32)12(35-17)11-34-38(27,28)29/h6,9,12,14-17H,1-5,7-8,10-11H2,(H2,20,24,25)(H4,21,22,23)(H2,27,28,29)(H2,30,31,32)/t12-,14?,15-,16-,17-/m1/s1 |
| InChIKey | LFWWBSUFHGVLDC-RFGVJUNNSA-N |
| XLogP | -1.18 |
| TPSA | 281.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|