C16H29N5O10P2 — CID 165053190
[(2R,3S,4R,5R)-5-[4-amino-2-[4-(1-aminoethylideneamino)butylimino]-1-pyridinyl]-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 165053190) has the molecular formula C16H29N5O10P2 and a molecular weight of 513.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-amino-2-[4-(1-aminoethylideneamino)butylimino]-1-pyridinyl]-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-amino-2-[4-(1-aminoethylideneamino)butylimino]-1-pyridinyl]-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 165053190 |
| Molecular Formula | C16H29N5O10P2 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-amino-2-[4-(1-aminoethylideneamino)butylimino]-1-pyridinyl]-4-hydroxy-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | C/C(N)=N\CCCC/N=c1\cc(N)ccn1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C16H29N5O10P2/c1-10(17)19-5-2-3-6-20-13-8-11(18)4-7-21(13)16-14(22)15(31-33(26,27)28)12(30-16)9-29-32(23,24)25/h4,7-8,12,14-16,22H,2-3,5-6,9,18H2,1H3,(H2,17,19)(H2,23,24,25)(H2,26,27,28)/b20-13+/t12-,14-,15-,16-/m1/s1 |
| InChIKey | PZMDVJWBCNLTID-ANQVTAEDSA-N |
| XLogP | -1.03 |
| TPSA | 244.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|