C32H25NO2Si — CID 164802865
trimethyl-[12-(2-phenyl-4-pyridinyl)-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaen-2-yl]silane (PubChem CID 164802865) has the molecular formula C32H25NO2Si and a molecular weight of 483.64 g/mol. Its IUPAC name is trimethyl-[12-(2-phenyl-4-pyridinyl)-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaen-2-yl]silane.
| Compound Name | trimethyl-[12-(2-phenyl-4-pyridinyl)-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaen-2-yl]silane |
|---|---|
| PubChem CID | 164802865 |
| Molecular Formula | C32H25NO2Si |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | trimethyl-[12-(2-phenyl-4-pyridinyl)-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4,6,8,12,15,17,19-nonaen-2-yl]silane |
| SMILES | C[Si](C)(C)c1c2c(oc3ccccc32)c(-c2ccnc(-c3ccccc3)c2)c2oc3ccccc3c12 |
| InChI | InChI=1S/C32H25NO2Si/c1-36(2,3)32-28-22-13-7-9-15-25(22)34-30(28)27(31-29(32)23-14-8-10-16-26(23)35-31)21-17-18-33-24(19-21)20-11-5-4-6-12-20/h4-19H,1-3H3 |
| InChIKey | RRQLQTFNSIABAK-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|