C26H18N2O — CID 171576860
2-(1-ethyldibenzofuran-4-yl)-4-(4-isocyanophenyl)pyridine (PubChem CID 171576860) has the molecular formula C26H18N2O and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-(1-ethyldibenzofuran-4-yl)-4-(4-isocyanophenyl)pyridine.
| Compound Name | 2-(1-ethyldibenzofuran-4-yl)-4-(4-isocyanophenyl)pyridine |
|---|---|
| PubChem CID | 171576860 |
| Molecular Formula | C26H18N2O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-(1-ethyldibenzofuran-4-yl)-4-(4-isocyanophenyl)pyridine |
| SMILES | [C-]#[N+]c1ccc(-c2ccnc(-c3ccc(CC)c4c3oc3ccccc34)c2)cc1 |
| InChI | InChI=1S/C26H18N2O/c1-3-17-10-13-21(26-25(17)22-6-4-5-7-24(22)29-26)23-16-19(14-15-28-23)18-8-11-20(27-2)12-9-18/h4-16H,3H2,1H3 |
| InChIKey | IJWFYRJEAMMIAW-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 30.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|