C29H27NO — CID 171576718
4-(4-tert-butylphenyl)-2-(1,9-dimethyldibenzofuran-4-yl)pyridine (PubChem CID 171576718) has the molecular formula C29H27NO and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-(1,9-dimethyldibenzofuran-4-yl)pyridine.
| Compound Name | 4-(4-tert-butylphenyl)-2-(1,9-dimethyldibenzofuran-4-yl)pyridine |
|---|---|
| PubChem CID | 171576718 |
| Molecular Formula | C29H27NO |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-(1,9-dimethyldibenzofuran-4-yl)pyridine |
| SMILES | Cc1cccc2oc3c(-c4cc(-c5ccc(C(C)(C)C)cc5)ccn4)ccc(C)c3c12 |
| InChI | InChI=1S/C29H27NO/c1-18-7-6-8-25-26(18)27-19(2)9-14-23(28(27)31-25)24-17-21(15-16-30-24)20-10-12-22(13-11-20)29(3,4)5/h6-17H,1-5H3 |
| InChIKey | XHEYJAVTNVLCBH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |