C30H43N3O — CID 164804162
N-tert-butyl-2-[(dibenzylamino)methyl]-5-ethenyl-1-(ethylamino)cyclohexane-1-carboxamide (PubChem CID 164804162) has the molecular formula C30H43N3O and a molecular weight of 461.69 g/mol. Its IUPAC name is N-tert-butyl-2-[(dibenzylamino)methyl]-5-ethenyl-1-(ethylamino)cyclohexane-1-carboxamide.
| Compound Name | N-tert-butyl-2-[(dibenzylamino)methyl]-5-ethenyl-1-(ethylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 164804162 |
| Molecular Formula | C30H43N3O |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | N-tert-butyl-2-[(dibenzylamino)methyl]-5-ethenyl-1-(ethylamino)cyclohexane-1-carboxamide |
| SMILES | C=CC1CCC(CN(Cc2ccccc2)Cc2ccccc2)C(NCC)(C(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C30H43N3O/c1-6-24-18-19-27(30(20-24,31-7-2)28(34)32-29(3,4)5)23-33(21-25-14-10-8-11-15-25)22-26-16-12-9-13-17-26/h6,8-17,24,27,31H,1,7,18-23H2,2-5H3,(H,32,34) |
| InChIKey | AHTNDPOIBPBHBP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|