C65H40IrN4+ — CID 164805188
CID 164805188 (PubChem CID 164805188) has the molecular formula C65H40IrN4+ and a molecular weight of 1069.28 g/mol.
| Compound Name | CID 164805188 |
|---|---|
| PubChem CID | 164805188 |
| Molecular Formula | C65H40IrN4+ |
| Molecular Weight | 1069.28 g/mol |
| Exact Mass | 1069.29 |
| IUPAC Name | — |
| SMILES | [Ir+3].[c-]1ccccc1-c1ccc(-c2ccccc2-c2cc(-c3ccccc3-c3ccc(-c4[c-]cccc4)nc3)cc(-c3ccccc3-c3cnc4c(c3)[N+]3=Cc5ccccc5C3c3ccc[c-]c3-4)c2)cn1 |
| InChI | InChI=1S/C65H40N4.Ir/c1-3-17-43(18-4-1)61-33-31-45(39-66-61)52-22-9-11-24-54(52)48-35-49(55-25-12-10-23-53(55)46-32-34-62(67-40-46)44-19-5-2-6-20-44)37-50(36-48)56-26-13-14-27-57(56)51-38-63-64(68-41-51)59-29-15-16-30-60(59)65-58-28-8-7-21-47(58)42-69(63)65;/h1-17,19,21-28,30-42,65H;/q-2;+3 |
| InChIKey | FBJGTMOALZTIME-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 41.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.28 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|