C21H44O4Si — CID 164806253
2-[propan-2-yl-di(propan-2-yloxy)silyl]ethyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 164806253) has the molecular formula C21H44O4Si and a molecular weight of 388.67 g/mol. Its IUPAC name is 2-[propan-2-yl-di(propan-2-yloxy)silyl]ethyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 2-[propan-2-yl-di(propan-2-yloxy)silyl]ethyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 164806253 |
| Molecular Formula | C21H44O4Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 2-[propan-2-yl-di(propan-2-yloxy)silyl]ethyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OCC[Si](OC(C)C)(OC(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C21H44O4Si/c1-15(2)14-21(11,16(3)4)20(22)23-12-13-26(19(9)10,24-17(5)6)25-18(7)8/h15-19H,12-14H2,1-11H3 |
| InChIKey | QZDUCQFRURVQTN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|