C19H26N6O2 — CID 164806734
(3R)-3-[4-[6-amino-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]pyrazol-1-yl]-3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)propanenitrile (PubChem CID 164806734) has the molecular formula C19H26N6O2 and a molecular weight of 378.51 g/mol. Its IUPAC name is (3R)-3-[4-[6-amino-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]pyrazol-1-yl]-3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)propanenitrile.
| Compound Name | (3R)-3-[4-[6-amino-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]pyrazol-1-yl]-3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)propanenitrile |
|---|---|
| PubChem CID | 164806734 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (3R)-3-[4-[6-amino-5-(2,2-dimethoxyethyl)pyrimidin-4-yl]pyrazol-1-yl]-3-(2,2,3,3,4,4,5,5-octadeuteriocyclopentyl)propanenitrile |
| SMILES | [2H]C1([2H])C([C@@H](CC#N)n2cc(-c3ncnc(N)c3CC(OC)OC)cn2)C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C19H26N6O2/c1-26-17(27-2)9-15-18(22-12-23-19(15)21)14-10-24-25(11-14)16(7-8-20)13-5-3-4-6-13/h10-13,16-17H,3-7,9H2,1-2H3,(H2,21,22,23)/t16-/m1/s1/i3D2,4D2,5D2,6D2 |
| InChIKey | UKLTVBBAUYVRLW-MPYLVDTPSA-N |
| XLogP | 2.73 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|